C26H20N6S2 — CID 3750406
1-[2-(benzotriazol-1-yl)-1,2-bis(phenylsulfanyl)ethyl]benzotriazole (PubChem CID 3750406) has the molecular formula C26H20N6S2 and a molecular weight of 480.62 g/mol. Its IUPAC name is 1-[2-(benzotriazol-1-yl)-1,2-bis(phenylsulfanyl)ethyl]benzotriazole.
| Compound Name | 1-[2-(benzotriazol-1-yl)-1,2-bis(phenylsulfanyl)ethyl]benzotriazole |
|---|---|
| PubChem CID | 3750406 |
| Molecular Formula | C26H20N6S2 |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 1-[2-(benzotriazol-1-yl)-1,2-bis(phenylsulfanyl)ethyl]benzotriazole |
| SMILES | c1ccc(SC(C(Sc2ccccc2)n2nnc3ccccc32)n2nnc3ccccc32)cc1 |
| InChI | InChI=1S/C26H20N6S2/c1-3-11-19(12-4-1)33-25(31-23-17-9-7-15-21(23)27-29-31)26(34-20-13-5-2-6-14-20)32-24-18-10-8-16-22(24)28-30-32/h1-18,25-26H |
| InChIKey | AIXMXMZBAGYTIW-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |