About benzotriazol-1-yl benzotriazol-1-yloxycarbonyl carbonate
benzotriazol-1-yl benzotriazol-1-yloxycarbonyl carbonate (PubChem CID 10290998) has the molecular formula C14H8N6O5
and a molecular weight of 340.26 g/mol. Its IUPAC name is benzotriazol-1-yl benzotriazol-1-yloxycarbonyl carbonate.
Molecular Properties
| Compound Name | benzotriazol-1-yl benzotriazol-1-yloxycarbonyl carbonate |
| PubChem CID | 10290998 |
| Molecular Formula | C14H8N6O5 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | benzotriazol-1-yl benzotriazol-1-yloxycarbonyl carbonate |
| SMILES | O=C(OC(=O)On1nnc2ccccc21)On1nnc2ccccc21 |
| InChI | InChI=1S/C14H8N6O5/c21-13(24-19-11-7-3-1-5-9(11)15-17-19)23-14(22)25-20-12-8-4-2-6-10(12)16-18-20/h1-8H |
| InChIKey | FRRCFLIIEYIPOO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 123.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'} |
|---|
Analyze benzotriazol-1-yl benzotriazol-1-yloxycarbonyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzotriazol-1-yl benzotriazol-1-yloxycarbonyl carbonate?
The IUPAC name of benzotriazol-1-yl benzotriazol-1-yloxycarbonyl carbonate (CID 10290998) is benzotriazol-1-yl benzotriazol-1-yloxycarbonyl carbonate.
What is the SMILES notation for benzotriazol-1-yl benzotriazol-1-yloxycarbonyl carbonate?
The canonical SMILES for benzotriazol-1-yl benzotriazol-1-yloxycarbonyl carbonate is O=C(OC(=O)On1nnc2ccccc21)On1nnc2ccccc21.
What is the InChIKey of benzotriazol-1-yl benzotriazol-1-yloxycarbonyl carbonate?
The InChIKey is FRRCFLIIEYIPOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N6O5/c21-13(24-19-11-7-3-1-5-9(11)15-17-19)23-14(22)25-20-12-8-4-2-6-10(12)16-18-20/h1-8H.
What are the key properties of benzotriazol-1-yl benzotriazol-1-yloxycarbonyl carbonate?
benzotriazol-1-yl benzotriazol-1-yloxycarbonyl carbonate has a molecular weight of 340.26 g/mol, XLogP of 0.99, 2 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for benzotriazol-1-yl benzotriazol-1-yloxycarbonyl carbonate is sourced from PubChem (CID 10290998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).