About bis(benzotriazol-1-yl) (2S)-2-benzylbutanedioate
bis(benzotriazol-1-yl) (2S)-2-benzylbutanedioate (PubChem CID 10718031) has the molecular formula C23H18N6O4
and a molecular weight of 442.44 g/mol. Its IUPAC name is bis(benzotriazol-1-yl) (2S)-2-benzylbutanedioate.
Molecular Properties
| Compound Name | bis(benzotriazol-1-yl) (2S)-2-benzylbutanedioate |
| PubChem CID | 10718031 |
| Molecular Formula | C23H18N6O4 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | bis(benzotriazol-1-yl) (2S)-2-benzylbutanedioate |
| SMILES | O=C(C[C@H](Cc1ccccc1)C(=O)On1nnc2ccccc21)On1nnc2ccccc21 |
| InChI | InChI=1S/C23H18N6O4/c30-22(32-28-20-12-6-4-10-18(20)24-26-28)15-17(14-16-8-2-1-3-9-16)23(31)33-29-21-13-7-5-11-19(21)25-27-29/h1-13,17H,14-15H2/t17-/m0/s1 |
| InChIKey | XYANAQNZXSCPPV-KRWDZBQOSA-N |
| XLogP | 2.04 |
| TPSA | 114.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'} |
|---|
Analyze bis(benzotriazol-1-yl) (2S)-2-benzylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(benzotriazol-1-yl) (2S)-2-benzylbutanedioate?
The IUPAC name of bis(benzotriazol-1-yl) (2S)-2-benzylbutanedioate (CID 10718031) is bis(benzotriazol-1-yl) (2S)-2-benzylbutanedioate.
What is the SMILES notation for bis(benzotriazol-1-yl) (2S)-2-benzylbutanedioate?
The canonical SMILES for bis(benzotriazol-1-yl) (2S)-2-benzylbutanedioate is O=C(C[C@H](Cc1ccccc1)C(=O)On1nnc2ccccc21)On1nnc2ccccc21.
What is the InChIKey of bis(benzotriazol-1-yl) (2S)-2-benzylbutanedioate?
The InChIKey is XYANAQNZXSCPPV-KRWDZBQOSA-N. The full InChI is InChI=1S/C23H18N6O4/c30-22(32-28-20-12-6-4-10-18(20)24-26-28)15-17(14-16-8-2-1-3-9-16)23(31)33-29-21-13-7-5-11-19(21)25-27-29/h1-13,17H,14-15H2/t17-/m0/s1.
What are the key properties of bis(benzotriazol-1-yl) (2S)-2-benzylbutanedioate?
bis(benzotriazol-1-yl) (2S)-2-benzylbutanedioate has a molecular weight of 442.44 g/mol, XLogP of 2.04, 7 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(benzotriazol-1-yl) (2S)-2-benzylbutanedioate is sourced from PubChem (CID 10718031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).