C14H13N3OS — CID 71911030
N-benzyl-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 71911030) has the molecular formula C14H13N3OS and a molecular weight of 271.35 g/mol. Its IUPAC name is N-benzyl-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-benzyl-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 71911030 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | N-benzyl-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1csc(C(C#N)C(=O)NCc2ccccc2)n1 |
| InChI | InChI=1S/C14H13N3OS/c1-10-9-19-14(17-10)12(7-15)13(18)16-8-11-5-3-2-4-6-11/h2-6,9,12H,8H2,1H3,(H,16,18) |
| InChIKey | SALMHNNSDPEYTQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |