C23H25N6O+ — CID 7367749
(2R)-N-benzyl-2-cyano-2-[3-(4-methylpiperazin-4-ium-1-yl)quinoxalin-2-yl]acetamide (PubChem CID 7367749) has the molecular formula C23H25N6O+ and a molecular weight of 401.49 g/mol. Its IUPAC name is (2R)-N-benzyl-2-cyano-2-[3-(4-methylpiperazin-4-ium-1-yl)quinoxalin-2-yl]acetamide.
| Compound Name | (2R)-N-benzyl-2-cyano-2-[3-(4-methylpiperazin-4-ium-1-yl)quinoxalin-2-yl]acetamide |
|---|---|
| PubChem CID | 7367749 |
| Molecular Formula | C23H25N6O+ |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | (2R)-N-benzyl-2-cyano-2-[3-(4-methylpiperazin-4-ium-1-yl)quinoxalin-2-yl]acetamide |
| SMILES | C[NH+]1CCN(c2nc3ccccc3nc2[C@H](C#N)C(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H24N6O/c1-28-11-13-29(14-12-28)22-21(26-19-9-5-6-10-20(19)27-22)18(15-24)23(30)25-16-17-7-3-2-4-8-17/h2-10,18H,11-14,16H2,1H3,(H,25,30)/p+1/t18-/m0/s1 |
| InChIKey | HEBPKYOFHYECGM-SFHVURJKSA-O |
| XLogP | 0.89 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |