C19H24N5O3+ — CID 7403781
2-methoxyethyl (2S)-2-cyano-2-[3-(4-methylpiperazin-4-ium-1-yl)quinoxalin-2-yl]acetate (PubChem CID 7403781) has the molecular formula C19H24N5O3+ and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-methoxyethyl (2S)-2-cyano-2-[3-(4-methylpiperazin-4-ium-1-yl)quinoxalin-2-yl]acetate.
| Compound Name | 2-methoxyethyl (2S)-2-cyano-2-[3-(4-methylpiperazin-4-ium-1-yl)quinoxalin-2-yl]acetate |
|---|---|
| PubChem CID | 7403781 |
| Molecular Formula | C19H24N5O3+ |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-methoxyethyl (2S)-2-cyano-2-[3-(4-methylpiperazin-4-ium-1-yl)quinoxalin-2-yl]acetate |
| SMILES | COCCOC(=O)[C@H](C#N)c1nc2ccccc2nc1N1CC[NH+](C)CC1 |
| InChI | InChI=1S/C19H23N5O3/c1-23-7-9-24(10-8-23)18-17(14(13-20)19(25)27-12-11-26-2)21-15-5-3-4-6-16(15)22-18/h3-6,14H,7-12H2,1-2H3/p+1/t14-/m1/s1 |
| InChIKey | BKNZVMSOKYDBCU-CQSZACIVSA-O |
| XLogP | -0.24 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|