C29H35N5O2 — CID 3821473
heptyl 2-[3-(4-benzylpiperazin-1-yl)quinoxalin-2-yl]-2-cyanoacetate (PubChem CID 3821473) has the molecular formula C29H35N5O2 and a molecular weight of 485.63 g/mol. Its IUPAC name is heptyl 2-[3-(4-benzylpiperazin-1-yl)quinoxalin-2-yl]-2-cyanoacetate.
| Compound Name | heptyl 2-[3-(4-benzylpiperazin-1-yl)quinoxalin-2-yl]-2-cyanoacetate |
|---|---|
| PubChem CID | 3821473 |
| Molecular Formula | C29H35N5O2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | heptyl 2-[3-(4-benzylpiperazin-1-yl)quinoxalin-2-yl]-2-cyanoacetate |
| SMILES | CCCCCCCOC(=O)C(C#N)c1nc2ccccc2nc1N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H35N5O2/c1-2-3-4-5-11-20-36-29(35)24(21-30)27-28(32-26-15-10-9-14-25(26)31-27)34-18-16-33(17-19-34)22-23-12-7-6-8-13-23/h6-10,12-15,24H,2-5,11,16-20,22H2,1H3 |
| InChIKey | WJDYQOAGXJLBOE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 82.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|