C28H30F3N5O2 — CID 40894933
hexyl (2S)-2-cyano-2-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]quinoxalin-2-yl]acetate (PubChem CID 40894933) has the molecular formula C28H30F3N5O2 and a molecular weight of 525.58 g/mol. Its IUPAC name is hexyl (2S)-2-cyano-2-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]quinoxalin-2-yl]acetate.
| Compound Name | hexyl (2S)-2-cyano-2-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]quinoxalin-2-yl]acetate |
|---|---|
| PubChem CID | 40894933 |
| Molecular Formula | C28H30F3N5O2 |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | hexyl (2S)-2-cyano-2-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]quinoxalin-2-yl]acetate |
| SMILES | CCCCCCOC(=O)[C@H](C#N)c1nc2ccccc2nc1N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C28H30F3N5O2/c1-2-3-4-7-17-38-27(37)22(19-32)25-26(34-24-12-6-5-11-23(24)33-25)36-15-13-35(14-16-36)21-10-8-9-20(18-21)28(29,30)31/h5-6,8-12,18,22H,2-4,7,13-17H2,1H3/t22-/m1/s1 |
| InChIKey | OTZFBGZBEBPXKP-JOCHJYFZSA-N |
| XLogP | 5.71 |
| TPSA | 82.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|