C22H27N5O2 — CID 135348554
cyclohexylmethyl 2-cyano-2-(3-piperazin-1-ylquinoxalin-2-yl)acetate (PubChem CID 135348554) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is cyclohexylmethyl 2-cyano-2-(3-piperazin-1-ylquinoxalin-2-yl)acetate.
| Compound Name | cyclohexylmethyl 2-cyano-2-(3-piperazin-1-ylquinoxalin-2-yl)acetate |
|---|---|
| PubChem CID | 135348554 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | cyclohexylmethyl 2-cyano-2-(3-piperazin-1-ylquinoxalin-2-yl)acetate |
| SMILES | N#CC(C(=O)OCC1CCCCC1)c1nc2ccccc2nc1N1CCNCC1 |
| InChI | InChI=1S/C22H27N5O2/c23-14-17(22(28)29-15-16-6-2-1-3-7-16)20-21(27-12-10-24-11-13-27)26-19-9-5-4-8-18(19)25-20/h4-5,8-9,16-17,24H,1-3,6-7,10-13,15H2 |
| InChIKey | MNNLNRXFQXSKAI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |