C31H29N5O2 — CID 28685563
prop-2-enyl (2S)-2-[3-(4-benzhydrylpiperazin-1-yl)quinoxalin-2-yl]-2-cyanoacetate (PubChem CID 28685563) has the molecular formula C31H29N5O2 and a molecular weight of 503.61 g/mol. Its IUPAC name is prop-2-enyl (2S)-2-[3-(4-benzhydrylpiperazin-1-yl)quinoxalin-2-yl]-2-cyanoacetate.
| Compound Name | prop-2-enyl (2S)-2-[3-(4-benzhydrylpiperazin-1-yl)quinoxalin-2-yl]-2-cyanoacetate |
|---|---|
| PubChem CID | 28685563 |
| Molecular Formula | C31H29N5O2 |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | prop-2-enyl (2S)-2-[3-(4-benzhydrylpiperazin-1-yl)quinoxalin-2-yl]-2-cyanoacetate |
| SMILES | C=CCOC(=O)[C@H](C#N)c1nc2ccccc2nc1N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C31H29N5O2/c1-2-21-38-31(37)25(22-32)28-30(34-27-16-10-9-15-26(27)33-28)36-19-17-35(18-20-36)29(23-11-5-3-6-12-23)24-13-7-4-8-14-24/h2-16,25,29H,1,17-21H2/t25-/m1/s1 |
| InChIKey | OEVNIGAPTOCQEH-RUZDIDTESA-N |
| XLogP | 4.88 |
| TPSA | 82.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|