C24H22ClN5O2 — CID 3249791
prop-2-enyl 2-[3-[4-(3-chlorophenyl)piperazin-1-yl]quinoxalin-2-yl]-2-cyanoacetate (PubChem CID 3249791) has the molecular formula C24H22ClN5O2 and a molecular weight of 447.93 g/mol. Its IUPAC name is prop-2-enyl 2-[3-[4-(3-chlorophenyl)piperazin-1-yl]quinoxalin-2-yl]-2-cyanoacetate.
| Compound Name | prop-2-enyl 2-[3-[4-(3-chlorophenyl)piperazin-1-yl]quinoxalin-2-yl]-2-cyanoacetate |
|---|---|
| PubChem CID | 3249791 |
| Molecular Formula | C24H22ClN5O2 |
| Molecular Weight | 447.93 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | prop-2-enyl 2-[3-[4-(3-chlorophenyl)piperazin-1-yl]quinoxalin-2-yl]-2-cyanoacetate |
| SMILES | C=CCOC(=O)C(C#N)c1nc2ccccc2nc1N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C24H22ClN5O2/c1-2-14-32-24(31)19(16-26)22-23(28-21-9-4-3-8-20(21)27-22)30-12-10-29(11-13-30)18-7-5-6-17(25)15-18/h2-9,15,19H,1,10-14H2 |
| InChIKey | VBYVZASMHUUGIH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 82.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.93 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|