C26H27F3N6O — CID 41030750
(2R)-N-butyl-2-cyano-2-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]quinoxalin-2-yl]acetamide (PubChem CID 41030750) has the molecular formula C26H27F3N6O and a molecular weight of 496.54 g/mol. Its IUPAC name is (2R)-N-butyl-2-cyano-2-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]quinoxalin-2-yl]acetamide.
| Compound Name | (2R)-N-butyl-2-cyano-2-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]quinoxalin-2-yl]acetamide |
|---|---|
| PubChem CID | 41030750 |
| Molecular Formula | C26H27F3N6O |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | (2R)-N-butyl-2-cyano-2-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]quinoxalin-2-yl]acetamide |
| SMILES | CCCCNC(=O)[C@@H](C#N)c1nc2ccccc2nc1N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C26H27F3N6O/c1-2-3-11-31-25(36)20(17-30)23-24(33-22-10-5-4-9-21(22)32-23)35-14-12-34(13-15-35)19-8-6-7-18(16-19)26(27,28)29/h4-10,16,20H,2-3,11-15H2,1H3,(H,31,36)/t20-/m0/s1 |
| InChIKey | KFQOWXSTXWTIEN-FQEVSTJZSA-N |
| XLogP | 4.50 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|