C25H27F3N4OS — CID 46090884
N-(3-methylsulfanylpropyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]quinoline-4-carboxamide (PubChem CID 46090884) has the molecular formula C25H27F3N4OS and a molecular weight of 488.58 g/mol. Its IUPAC name is N-(3-methylsulfanylpropyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]quinoline-4-carboxamide.
| Compound Name | N-(3-methylsulfanylpropyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 46090884 |
| Molecular Formula | C25H27F3N4OS |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-(3-methylsulfanylpropyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]quinoline-4-carboxamide |
| SMILES | CSCCCNC(=O)c1cc(N2CCN(c3cccc(C(F)(F)F)c3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C25H27F3N4OS/c1-34-15-5-10-29-24(33)21-17-23(30-22-9-3-2-8-20(21)22)32-13-11-31(12-14-32)19-7-4-6-18(16-19)25(26,27)28/h2-4,6-9,16-17H,5,10-15H2,1H3,(H,29,33) |
| InChIKey | ZNDMQZPNCMPBMW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|