C25H28F3N3O2S — CID 42744071
N-butyl-6-[4-oxo-3-[3-(trifluoromethyl)phenyl]quinazolin-2-yl]sulfanylhexanamide (PubChem CID 42744071) has the molecular formula C25H28F3N3O2S and a molecular weight of 491.58 g/mol. Its IUPAC name is N-butyl-6-[4-oxo-3-[3-(trifluoromethyl)phenyl]quinazolin-2-yl]sulfanylhexanamide.
| Compound Name | N-butyl-6-[4-oxo-3-[3-(trifluoromethyl)phenyl]quinazolin-2-yl]sulfanylhexanamide |
|---|---|
| PubChem CID | 42744071 |
| Molecular Formula | C25H28F3N3O2S |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | N-butyl-6-[4-oxo-3-[3-(trifluoromethyl)phenyl]quinazolin-2-yl]sulfanylhexanamide |
| SMILES | CCCCNC(=O)CCCCCSc1nc2ccccc2c(=O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H28F3N3O2S/c1-2-3-15-29-22(32)14-5-4-8-16-34-24-30-21-13-7-6-12-20(21)23(33)31(24)19-11-9-10-18(17-19)25(26,27)28/h6-7,9-13,17H,2-5,8,14-16H2,1H3,(H,29,32) |
| InChIKey | DOJZPMANVOYBEJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|