C22H24ClN3O2S — CID 42734609
5-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-propan-2-ylpentanamide (PubChem CID 42734609) has the molecular formula C22H24ClN3O2S and a molecular weight of 429.97 g/mol. Its IUPAC name is 5-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-propan-2-ylpentanamide.
| Compound Name | 5-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-propan-2-ylpentanamide |
|---|---|
| PubChem CID | 42734609 |
| Molecular Formula | C22H24ClN3O2S |
| Molecular Weight | 429.97 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 5-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-propan-2-ylpentanamide |
| SMILES | CC(C)NC(=O)CCCCSc1nc2ccccc2c(=O)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H24ClN3O2S/c1-15(2)24-20(27)12-5-6-13-29-22-25-19-11-4-3-10-18(19)21(28)26(22)17-9-7-8-16(23)14-17/h3-4,7-11,14-15H,5-6,12-13H2,1-2H3,(H,24,27) |
| InChIKey | WIPAVNHKHCLRFN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.97 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|