C25H28ClN3O3S — CID 42734630
3-(3-chlorophenyl)-2-[5-(2,6-dimethylmorpholin-4-yl)-5-oxopentyl]sulfanylquinazolin-4-one (PubChem CID 42734630) has the molecular formula C25H28ClN3O3S and a molecular weight of 486.04 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-2-[5-(2,6-dimethylmorpholin-4-yl)-5-oxopentyl]sulfanylquinazolin-4-one.
| Compound Name | 3-(3-chlorophenyl)-2-[5-(2,6-dimethylmorpholin-4-yl)-5-oxopentyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 42734630 |
| Molecular Formula | C25H28ClN3O3S |
| Molecular Weight | 486.04 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 3-(3-chlorophenyl)-2-[5-(2,6-dimethylmorpholin-4-yl)-5-oxopentyl]sulfanylquinazolin-4-one |
| SMILES | CC1CN(C(=O)CCCCSc2nc3ccccc3c(=O)n2-c2cccc(Cl)c2)CC(C)O1 |
| InChI | InChI=1S/C25H28ClN3O3S/c1-17-15-28(16-18(2)32-17)23(30)12-5-6-13-33-25-27-22-11-4-3-10-21(22)24(31)29(25)20-9-7-8-19(26)14-20/h3-4,7-11,14,17-18H,5-6,12-13,15-16H2,1-2H3 |
| InChIKey | UWELWQGGUZQFKH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.04 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|