C31H26ClN3O2S — CID 42734646
N-benzhydryl-4-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanylbutanamide (PubChem CID 42734646) has the molecular formula C31H26ClN3O2S and a molecular weight of 540.09 g/mol. Its IUPAC name is N-benzhydryl-4-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanylbutanamide.
| Compound Name | N-benzhydryl-4-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanylbutanamide |
|---|---|
| PubChem CID | 42734646 |
| Molecular Formula | C31H26ClN3O2S |
| Molecular Weight | 540.09 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | N-benzhydryl-4-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanylbutanamide |
| SMILES | O=C(CCCSc1nc2ccccc2c(=O)n1-c1cccc(Cl)c1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H26ClN3O2S/c32-24-15-9-16-25(21-24)35-30(37)26-17-7-8-18-27(26)33-31(35)38-20-10-19-28(36)34-29(22-11-3-1-4-12-22)23-13-5-2-6-14-23/h1-9,11-18,21,29H,10,19-20H2,(H,34,36) |
| InChIKey | XLRSSAIQHZSWCW-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.09 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|