C27H27N3O2S — CID 2542591
N-(2,6-dimethylphenyl)-4-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylbutanamide (PubChem CID 2542591) has the molecular formula C27H27N3O2S and a molecular weight of 457.60 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylbutanamide.
| Compound Name | N-(2,6-dimethylphenyl)-4-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylbutanamide |
|---|---|
| PubChem CID | 2542591 |
| Molecular Formula | C27H27N3O2S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylbutanamide |
| SMILES | Cc1cccc(-n2c(SCCCC(=O)Nc3c(C)cccc3C)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C27H27N3O2S/c1-18-9-6-12-21(17-18)30-26(32)22-13-4-5-14-23(22)28-27(30)33-16-8-15-24(31)29-25-19(2)10-7-11-20(25)3/h4-7,9-14,17H,8,15-16H2,1-3H3,(H,29,31) |
| InChIKey | QXQVIRDVYORNBT-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|