C25H23ClN4O2S — CID 42734658
4-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-pyridin-2-ylethyl)butanamide (PubChem CID 42734658) has the molecular formula C25H23ClN4O2S and a molecular weight of 479.01 g/mol. Its IUPAC name is 4-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-pyridin-2-ylethyl)butanamide.
| Compound Name | 4-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-pyridin-2-ylethyl)butanamide |
|---|---|
| PubChem CID | 42734658 |
| Molecular Formula | C25H23ClN4O2S |
| Molecular Weight | 479.01 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 4-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-pyridin-2-ylethyl)butanamide |
| SMILES | O=C(CCCSc1nc2ccccc2c(=O)n1-c1cccc(Cl)c1)NCCc1ccccn1 |
| InChI | InChI=1S/C25H23ClN4O2S/c26-18-7-5-9-20(17-18)30-24(32)21-10-1-2-11-22(21)29-25(30)33-16-6-12-23(31)28-15-13-19-8-3-4-14-27-19/h1-5,7-11,14,17H,6,12-13,15-16H2,(H,28,31) |
| InChIKey | ASKZZPZHPHEORZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.01 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|