C27H23Cl4N3O2S — CID 4265126
N-[2-(2,4-dichlorophenyl)ethyl]-5-[3-(2,4-dichlorophenyl)-4-oxoquinazolin-2-yl]sulfanylpentanamide (PubChem CID 4265126) has the molecular formula C27H23Cl4N3O2S and a molecular weight of 595.38 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-5-[3-(2,4-dichlorophenyl)-4-oxoquinazolin-2-yl]sulfanylpentanamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-5-[3-(2,4-dichlorophenyl)-4-oxoquinazolin-2-yl]sulfanylpentanamide |
|---|---|
| PubChem CID | 4265126 |
| Molecular Formula | C27H23Cl4N3O2S |
| Molecular Weight | 595.38 g/mol |
| Exact Mass | 593.03 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-5-[3-(2,4-dichlorophenyl)-4-oxoquinazolin-2-yl]sulfanylpentanamide |
| SMILES | O=C(CCCCSc1nc2ccccc2c(=O)n1-c1ccc(Cl)cc1Cl)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H23Cl4N3O2S/c28-18-9-8-17(21(30)15-18)12-13-32-25(35)7-3-4-14-37-27-33-23-6-2-1-5-20(23)26(36)34(27)24-11-10-19(29)16-22(24)31/h1-2,5-6,8-11,15-16H,3-4,7,12-14H2,(H,32,35) |
| InChIKey | RVBHNNGOGZEYED-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.38 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|