C25H26Cl2FN3O2S — CID 42739291
N-[2-(2,4-dichlorophenyl)ethyl]-4-[5-[(2-fluorophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanylbutanamide (PubChem CID 42739291) has the molecular formula C25H26Cl2FN3O2S and a molecular weight of 522.47 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-4-[5-[(2-fluorophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanylbutanamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-4-[5-[(2-fluorophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanylbutanamide |
|---|---|
| PubChem CID | 42739291 |
| Molecular Formula | C25H26Cl2FN3O2S |
| Molecular Weight | 522.47 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-4-[5-[(2-fluorophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanylbutanamide |
| SMILES | Cc1nc(SCCCC(=O)NCCc2ccc(Cl)cc2Cl)n(C)c(=O)c1Cc1ccccc1F |
| InChI | InChI=1S/C25H26Cl2FN3O2S/c1-16-20(14-18-6-3-4-7-22(18)28)24(33)31(2)25(30-16)34-13-5-8-23(32)29-12-11-17-9-10-19(26)15-21(17)27/h3-4,6-7,9-10,15H,5,8,11-14H2,1-2H3,(H,29,32) |
| InChIKey | IBSNBRJISNNRGM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.47 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|