C25H26Cl3N3O2S — CID 42738988
4-[5-[(3-chlorophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanyl-N-[2-(2,4-dichlorophenyl)ethyl]butanamide (PubChem CID 42738988) has the molecular formula C25H26Cl3N3O2S and a molecular weight of 538.93 g/mol. Its IUPAC name is 4-[5-[(3-chlorophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanyl-N-[2-(2,4-dichlorophenyl)ethyl]butanamide.
| Compound Name | 4-[5-[(3-chlorophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanyl-N-[2-(2,4-dichlorophenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 42738988 |
| Molecular Formula | C25H26Cl3N3O2S |
| Molecular Weight | 538.93 g/mol |
| Exact Mass | 537.08 |
| IUPAC Name | 4-[5-[(3-chlorophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanyl-N-[2-(2,4-dichlorophenyl)ethyl]butanamide |
| SMILES | Cc1nc(SCCCC(=O)NCCc2ccc(Cl)cc2Cl)n(C)c(=O)c1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H26Cl3N3O2S/c1-16-21(14-17-5-3-6-19(26)13-17)24(33)31(2)25(30-16)34-12-4-7-23(32)29-11-10-18-8-9-20(27)15-22(18)28/h3,5-6,8-9,13,15H,4,7,10-12,14H2,1-2H3,(H,29,32) |
| InChIKey | RKUISKVEYSHIFR-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.93 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|