C29H28Cl2N4O2S — CID 3904803
3-(2,4-dichlorophenyl)-2-[4-[4-(2-methylphenyl)piperazin-1-yl]-4-oxobutyl]sulfanylquinazolin-4-one (PubChem CID 3904803) has the molecular formula C29H28Cl2N4O2S and a molecular weight of 567.54 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-2-[4-[4-(2-methylphenyl)piperazin-1-yl]-4-oxobutyl]sulfanylquinazolin-4-one.
| Compound Name | 3-(2,4-dichlorophenyl)-2-[4-[4-(2-methylphenyl)piperazin-1-yl]-4-oxobutyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 3904803 |
| Molecular Formula | C29H28Cl2N4O2S |
| Molecular Weight | 567.54 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-2-[4-[4-(2-methylphenyl)piperazin-1-yl]-4-oxobutyl]sulfanylquinazolin-4-one |
| SMILES | Cc1ccccc1N1CCN(C(=O)CCCSc2nc3ccccc3c(=O)n2-c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C29H28Cl2N4O2S/c1-20-7-2-5-10-25(20)33-14-16-34(17-15-33)27(36)11-6-18-38-29-32-24-9-4-3-8-22(24)28(37)35(29)26-13-12-21(30)19-23(26)31/h2-5,7-10,12-13,19H,6,11,14-18H2,1H3 |
| InChIKey | QJUJMNYDMGWSKE-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.54 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|