C31H30F4N4O2S — CID 3637227
2-[6-[4-(2-fluorophenyl)piperazin-1-yl]-6-oxohexyl]sulfanyl-3-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 3637227) has the molecular formula C31H30F4N4O2S and a molecular weight of 598.67 g/mol. Its IUPAC name is 2-[6-[4-(2-fluorophenyl)piperazin-1-yl]-6-oxohexyl]sulfanyl-3-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 2-[6-[4-(2-fluorophenyl)piperazin-1-yl]-6-oxohexyl]sulfanyl-3-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 3637227 |
| Molecular Formula | C31H30F4N4O2S |
| Molecular Weight | 598.67 g/mol |
| Exact Mass | 598.20 |
| IUPAC Name | 2-[6-[4-(2-fluorophenyl)piperazin-1-yl]-6-oxohexyl]sulfanyl-3-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | O=C(CCCCCSc1nc2ccccc2c(=O)n1-c1cccc(C(F)(F)F)c1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C31H30F4N4O2S/c32-25-12-4-6-14-27(25)37-16-18-38(19-17-37)28(40)15-2-1-7-20-42-30-36-26-13-5-3-11-24(26)29(41)39(30)23-10-8-9-22(21-23)31(33,34)35/h3-6,8-14,21H,1-2,7,15-20H2 |
| InChIKey | HBCQNKQKBOIWNM-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.67 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|