C26H29FN4O3S — CID 42744062
2-[6-(4-acetylpiperazin-1-yl)-6-oxohexyl]sulfanyl-3-(4-fluorophenyl)quinazolin-4-one (PubChem CID 42744062) has the molecular formula C26H29FN4O3S and a molecular weight of 496.61 g/mol. Its IUPAC name is 2-[6-(4-acetylpiperazin-1-yl)-6-oxohexyl]sulfanyl-3-(4-fluorophenyl)quinazolin-4-one.
| Compound Name | 2-[6-(4-acetylpiperazin-1-yl)-6-oxohexyl]sulfanyl-3-(4-fluorophenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 42744062 |
| Molecular Formula | C26H29FN4O3S |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 2-[6-(4-acetylpiperazin-1-yl)-6-oxohexyl]sulfanyl-3-(4-fluorophenyl)quinazolin-4-one |
| SMILES | CC(=O)N1CCN(C(=O)CCCCCSc2nc3ccccc3c(=O)n2-c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C26H29FN4O3S/c1-19(32)29-14-16-30(17-15-29)24(33)9-3-2-6-18-35-26-28-23-8-5-4-7-22(23)25(34)31(26)21-12-10-20(27)11-13-21/h4-5,7-8,10-13H,2-3,6,9,14-18H2,1H3 |
| InChIKey | KTKPSOFUOGCMEP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|