C25H31FN4O2S — CID 3901678
N-(6-aminohexyl)-5-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpentanamide (PubChem CID 3901678) has the molecular formula C25H31FN4O2S and a molecular weight of 470.61 g/mol. Its IUPAC name is N-(6-aminohexyl)-5-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpentanamide.
| Compound Name | N-(6-aminohexyl)-5-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpentanamide |
|---|---|
| PubChem CID | 3901678 |
| Molecular Formula | C25H31FN4O2S |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | N-(6-aminohexyl)-5-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpentanamide |
| SMILES | NCCCCCCNC(=O)CCCCSc1nc2ccccc2c(=O)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H31FN4O2S/c26-19-12-14-20(15-13-19)30-24(32)21-9-3-4-10-22(21)29-25(30)33-18-8-5-11-23(31)28-17-7-2-1-6-16-27/h3-4,9-10,12-15H,1-2,5-8,11,16-18,27H2,(H,28,31) |
| InChIKey | NFCDIKYAKTVHRG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|