C25H29FN4O3S — CID 42736302
4-[3-(3-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(3-morpholin-4-ylpropyl)butanamide (PubChem CID 42736302) has the molecular formula C25H29FN4O3S and a molecular weight of 484.60 g/mol. Its IUPAC name is 4-[3-(3-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(3-morpholin-4-ylpropyl)butanamide.
| Compound Name | 4-[3-(3-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(3-morpholin-4-ylpropyl)butanamide |
|---|---|
| PubChem CID | 42736302 |
| Molecular Formula | C25H29FN4O3S |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 4-[3-(3-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(3-morpholin-4-ylpropyl)butanamide |
| SMILES | O=C(CCCSc1nc2ccccc2c(=O)n1-c1cccc(F)c1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C25H29FN4O3S/c26-19-6-3-7-20(18-19)30-24(32)21-8-1-2-9-22(21)28-25(30)34-17-4-10-23(31)27-11-5-12-29-13-15-33-16-14-29/h1-3,6-9,18H,4-5,10-17H2,(H,27,31) |
| InChIKey | UWKJMYHAWKQFBN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|