C26H33N5O3S — CID 42741736
4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-morpholin-4-ylpropyl)butanamide (PubChem CID 42741736) has the molecular formula C26H33N5O3S and a molecular weight of 495.65 g/mol. Its IUPAC name is 4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-morpholin-4-ylpropyl)butanamide.
| Compound Name | 4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-morpholin-4-ylpropyl)butanamide |
|---|---|
| PubChem CID | 42741736 |
| Molecular Formula | C26H33N5O3S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-morpholin-4-ylpropyl)butanamide |
| SMILES | COc1cccc(-c2nnc(SCCCC(=O)NCCCN3CCOCC3)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C26H33N5O3S/c1-33-23-11-5-8-21(20-23)25-28-29-26(31(25)22-9-3-2-4-10-22)35-19-6-12-24(32)27-13-7-14-30-15-17-34-18-16-30/h2-5,8-11,20H,6-7,12-19H2,1H3,(H,27,32) |
| InChIKey | NHSOAPAIIFAJED-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|