C28H37N5O2S — CID 42741734
4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(2-methylpiperidin-1-yl)propyl]butanamide (PubChem CID 42741734) has the molecular formula C28H37N5O2S and a molecular weight of 507.70 g/mol. Its IUPAC name is 4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(2-methylpiperidin-1-yl)propyl]butanamide.
| Compound Name | 4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(2-methylpiperidin-1-yl)propyl]butanamide |
|---|---|
| PubChem CID | 42741734 |
| Molecular Formula | C28H37N5O2S |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | 4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(2-methylpiperidin-1-yl)propyl]butanamide |
| SMILES | COc1cccc(-c2nnc(SCCCC(=O)NCCCN3CCCCC3C)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C28H37N5O2S/c1-22-11-6-7-18-32(22)19-10-17-29-26(34)16-9-20-36-28-31-30-27(23-12-8-15-25(21-23)35-2)33(28)24-13-4-3-5-14-24/h3-5,8,12-15,21-22H,6-7,9-11,16-20H2,1-2H3,(H,29,34) |
| InChIKey | XVQIRIWFVXYMLD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|