C25H31N5OS — CID 3950732
4-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-piperidin-1-ylethyl)butanamide (PubChem CID 3950732) has the molecular formula C25H31N5OS and a molecular weight of 449.62 g/mol. Its IUPAC name is 4-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-piperidin-1-ylethyl)butanamide.
| Compound Name | 4-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-piperidin-1-ylethyl)butanamide |
|---|---|
| PubChem CID | 3950732 |
| Molecular Formula | C25H31N5OS |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 4-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-piperidin-1-ylethyl)butanamide |
| SMILES | O=C(CCCSc1nnc(-c2ccccc2)n1-c1ccccc1)NCCN1CCCCC1 |
| InChI | InChI=1S/C25H31N5OS/c31-23(26-16-19-29-17-8-3-9-18-29)15-10-20-32-25-28-27-24(21-11-4-1-5-12-21)30(25)22-13-6-2-7-14-22/h1-2,4-7,11-14H,3,8-10,15-20H2,(H,26,31) |
| InChIKey | DHTUHKCDJVBPOY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|