C26H32ClN5OS — CID 4211740
4-[[4-(3-chlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-piperidin-1-ylethyl)butanamide (PubChem CID 4211740) has the molecular formula C26H32ClN5OS and a molecular weight of 498.10 g/mol. Its IUPAC name is 4-[[4-(3-chlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-piperidin-1-ylethyl)butanamide.
| Compound Name | 4-[[4-(3-chlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-piperidin-1-ylethyl)butanamide |
|---|---|
| PubChem CID | 4211740 |
| Molecular Formula | C26H32ClN5OS |
| Molecular Weight | 498.10 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 4-[[4-(3-chlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-piperidin-1-ylethyl)butanamide |
| SMILES | Cc1ccc(-c2nnc(SCCCC(=O)NCCN3CCCCC3)n2-c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C26H32ClN5OS/c1-20-10-12-21(13-11-20)25-29-30-26(32(25)23-8-5-7-22(27)19-23)34-18-6-9-24(33)28-14-17-31-15-3-2-4-16-31/h5,7-8,10-13,19H,2-4,6,9,14-18H2,1H3,(H,28,33) |
| InChIKey | HQGZXIAERWCRHZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.10 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|