C24H31N5O2S — CID 42731014
4-[[5-(furan-2-yl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-piperidin-1-ylethyl)butanamide (PubChem CID 42731014) has the molecular formula C24H31N5O2S and a molecular weight of 453.61 g/mol. Its IUPAC name is 4-[[5-(furan-2-yl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-piperidin-1-ylethyl)butanamide.
| Compound Name | 4-[[5-(furan-2-yl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-piperidin-1-ylethyl)butanamide |
|---|---|
| PubChem CID | 42731014 |
| Molecular Formula | C24H31N5O2S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 4-[[5-(furan-2-yl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-piperidin-1-ylethyl)butanamide |
| SMILES | Cc1ccccc1-n1c(SCCCC(=O)NCCN2CCCCC2)nnc1-c1ccco1 |
| InChI | InChI=1S/C24H31N5O2S/c1-19-9-3-4-10-20(19)29-23(21-11-7-17-31-21)26-27-24(29)32-18-8-12-22(30)25-13-16-28-14-5-2-6-15-28/h3-4,7,9-11,17H,2,5-6,8,12-16,18H2,1H3,(H,25,30) |
| InChIKey | XHMAHCCPWGAJHV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|