C20H24N4O2S — CID 42731011
4-[[5-(furan-2-yl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-propylbutanamide (PubChem CID 42731011) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 4-[[5-(furan-2-yl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-propylbutanamide.
| Compound Name | 4-[[5-(furan-2-yl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-propylbutanamide |
|---|---|
| PubChem CID | 42731011 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 4-[[5-(furan-2-yl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-propylbutanamide |
| SMILES | CCCNC(=O)CCCSc1nnc(-c2ccco2)n1-c1ccccc1C |
| InChI | InChI=1S/C20H24N4O2S/c1-3-12-21-18(25)11-7-14-27-20-23-22-19(17-10-6-13-26-17)24(20)16-9-5-4-8-15(16)2/h4-6,8-10,13H,3,7,11-12,14H2,1-2H3,(H,21,25) |
| InChIKey | JKUBVHKWSOLBJV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|