C23H25N5O2S2 — CID 4031171
2-[[5-(furan-2-yl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-pentyl-1,3-thiazole-4-carboxamide (PubChem CID 4031171) has the molecular formula C23H25N5O2S2 and a molecular weight of 467.62 g/mol. Its IUPAC name is 2-[[5-(furan-2-yl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-pentyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[5-(furan-2-yl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-pentyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 4031171 |
| Molecular Formula | C23H25N5O2S2 |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 2-[[5-(furan-2-yl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-pentyl-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCNC(=O)c1csc(CSc2nnc(-c3ccco3)n2-c2ccccc2C)n1 |
| InChI | InChI=1S/C23H25N5O2S2/c1-3-4-7-12-24-22(29)17-14-31-20(25-17)15-32-23-27-26-21(19-11-8-13-30-19)28(23)18-10-6-5-9-16(18)2/h5-6,8-11,13-14H,3-4,7,12,15H2,1-2H3,(H,24,29) |
| InChIKey | LYMSEBIERVVCQP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|