C19H16FN5O3S2 — CID 3420422
N-ethoxy-2-[[4-(2-fluorophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazole-4-carboxamide (PubChem CID 3420422) has the molecular formula C19H16FN5O3S2 and a molecular weight of 445.50 g/mol. Its IUPAC name is N-ethoxy-2-[[4-(2-fluorophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-ethoxy-2-[[4-(2-fluorophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3420422 |
| Molecular Formula | C19H16FN5O3S2 |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | N-ethoxy-2-[[4-(2-fluorophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCONC(=O)c1csc(CSc2nnc(-c3ccco3)n2-c2ccccc2F)n1 |
| InChI | InChI=1S/C19H16FN5O3S2/c1-2-28-24-18(26)13-10-29-16(21-13)11-30-19-23-22-17(15-8-5-9-27-15)25(19)14-7-4-3-6-12(14)20/h3-10H,2,11H2,1H3,(H,24,26) |
| InChIKey | PJEVYKFHKVTGKR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|