C24H23Cl2N5OS2 — CID 3428568
2-[[4,5-bis(2-chlorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-pentyl-1,3-thiazole-4-carboxamide (PubChem CID 3428568) has the molecular formula C24H23Cl2N5OS2 and a molecular weight of 532.52 g/mol. Its IUPAC name is 2-[[4,5-bis(2-chlorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-pentyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[4,5-bis(2-chlorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-pentyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3428568 |
| Molecular Formula | C24H23Cl2N5OS2 |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 531.07 |
| IUPAC Name | 2-[[4,5-bis(2-chlorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-pentyl-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCNC(=O)c1csc(CSc2nnc(-c3ccccc3Cl)n2-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C24H23Cl2N5OS2/c1-2-3-8-13-27-23(32)19-14-33-21(28-19)15-34-24-30-29-22(16-9-4-5-10-17(16)25)31(24)20-12-7-6-11-18(20)26/h4-7,9-12,14H,2-3,8,13,15H2,1H3,(H,27,32) |
| InChIKey | RZMUKUCRTNQKBB-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|