C26H27Cl2N5O2S2 — CID 42770145
2-[[4-(2,5-dichlorophenyl)-5-(3-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-hexyl-1,3-thiazole-4-carboxamide (PubChem CID 42770145) has the molecular formula C26H27Cl2N5O2S2 and a molecular weight of 576.58 g/mol. Its IUPAC name is 2-[[4-(2,5-dichlorophenyl)-5-(3-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-hexyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[4-(2,5-dichlorophenyl)-5-(3-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-hexyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 42770145 |
| Molecular Formula | C26H27Cl2N5O2S2 |
| Molecular Weight | 576.58 g/mol |
| Exact Mass | 575.10 |
| IUPAC Name | 2-[[4-(2,5-dichlorophenyl)-5-(3-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-hexyl-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCCNC(=O)c1csc(CSc2nnc(-c3cccc(OC)c3)n2-c2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C26H27Cl2N5O2S2/c1-3-4-5-6-12-29-25(34)21-15-36-23(30-21)16-37-26-32-31-24(17-8-7-9-19(13-17)35-2)33(26)22-14-18(27)10-11-20(22)28/h7-11,13-15H,3-6,12,16H2,1-2H3,(H,29,34) |
| InChIKey | UXALWXMGEWQRCO-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.58 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|