C21H20ClN5O2S2 — CID 3997059
N-butyl-2-[[4-(3-chlorophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazole-4-carboxamide (PubChem CID 3997059) has the molecular formula C21H20ClN5O2S2 and a molecular weight of 474.01 g/mol. Its IUPAC name is N-butyl-2-[[4-(3-chlorophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-butyl-2-[[4-(3-chlorophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3997059 |
| Molecular Formula | C21H20ClN5O2S2 |
| Molecular Weight | 474.01 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | N-butyl-2-[[4-(3-chlorophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1csc(CSc2nnc(-c3ccco3)n2-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C21H20ClN5O2S2/c1-2-3-9-23-20(28)16-12-30-18(24-16)13-31-21-26-25-19(17-8-5-10-29-17)27(21)15-7-4-6-14(22)11-15/h4-8,10-12H,2-3,9,13H2,1H3,(H,23,28) |
| InChIKey | WYKCIBBWZAIZHH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.01 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|