C22H27N5O2S2 — CID 42741449
N-(2-morpholin-4-ylethyl)-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanamide (PubChem CID 42741449) has the molecular formula C22H27N5O2S2 and a molecular weight of 457.63 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 42741449 |
| Molecular Formula | C22H27N5O2S2 |
| Molecular Weight | 457.63 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanamide |
| SMILES | O=C(CCCSc1nnc(-c2cccs2)n1-c1ccccc1)NCCN1CCOCC1 |
| InChI | InChI=1S/C22H27N5O2S2/c28-20(23-10-11-26-12-14-29-15-13-26)9-5-17-31-22-25-24-21(19-8-4-16-30-19)27(22)18-6-2-1-3-7-18/h1-4,6-8,16H,5,9-15,17H2,(H,23,28) |
| InChIKey | RPWVEJKAHSKPCE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.63 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|