C20H25N5OS2 — CID 42741460
N-[2-(dimethylamino)ethyl]-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanamide (PubChem CID 42741460) has the molecular formula C20H25N5OS2 and a molecular weight of 415.59 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 42741460 |
| Molecular Formula | C20H25N5OS2 |
| Molecular Weight | 415.59 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanamide |
| SMILES | CN(C)CCNC(=O)CCCSc1nnc(-c2cccs2)n1-c1ccccc1 |
| InChI | InChI=1S/C20H25N5OS2/c1-24(2)13-12-21-18(26)11-7-15-28-20-23-22-19(17-10-6-14-27-17)25(20)16-8-4-3-5-9-16/h3-6,8-10,14H,7,11-13,15H2,1-2H3,(H,21,26) |
| InChIKey | FOTMKTXSDMUUIM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.59 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|