C19H20N4OS2 — CID 42741458
N-cyclopropyl-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanamide (PubChem CID 42741458) has the molecular formula C19H20N4OS2 and a molecular weight of 384.53 g/mol. Its IUPAC name is N-cyclopropyl-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanamide.
| Compound Name | N-cyclopropyl-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 42741458 |
| Molecular Formula | C19H20N4OS2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N-cyclopropyl-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanamide |
| SMILES | O=C(CCCSc1nnc(-c2cccs2)n1-c1ccccc1)NC1CC1 |
| InChI | InChI=1S/C19H20N4OS2/c24-17(20-14-10-11-14)9-5-13-26-19-22-21-18(16-8-4-12-25-16)23(19)15-6-2-1-3-7-15/h1-4,6-8,12,14H,5,9-11,13H2,(H,20,24) |
| InChIKey | NFIMCXREUQKXFK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|