C20H17N3OS3 — CID 7846546
4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-1-thiophen-2-ylbutan-1-one (PubChem CID 7846546) has the molecular formula C20H17N3OS3 and a molecular weight of 411.58 g/mol. Its IUPAC name is 4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-1-thiophen-2-ylbutan-1-one.
| Compound Name | 4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-1-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 7846546 |
| Molecular Formula | C20H17N3OS3 |
| Molecular Weight | 411.58 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-1-thiophen-2-ylbutan-1-one |
| SMILES | O=C(CCCSc1nnc(-c2cccs2)n1-c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C20H17N3OS3/c24-16(17-10-5-12-25-17)9-4-14-27-20-22-21-19(18-11-6-13-26-18)23(20)15-7-2-1-3-8-15/h1-3,5-8,10-13H,4,9,14H2 |
| InChIKey | JGRVQTSKWWDKKO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.58 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|