C22H18N2O2S2 — CID 2456292
2-(4-oxo-4-thiophen-2-ylbutyl)sulfanyl-3-phenylquinazolin-4-one (PubChem CID 2456292) has the molecular formula C22H18N2O2S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-(4-oxo-4-thiophen-2-ylbutyl)sulfanyl-3-phenylquinazolin-4-one.
| Compound Name | 2-(4-oxo-4-thiophen-2-ylbutyl)sulfanyl-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 2456292 |
| Molecular Formula | C22H18N2O2S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 2-(4-oxo-4-thiophen-2-ylbutyl)sulfanyl-3-phenylquinazolin-4-one |
| SMILES | O=C(CCCSc1nc2ccccc2c(=O)n1-c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C22H18N2O2S2/c25-19(20-13-7-14-27-20)12-6-15-28-22-23-18-11-5-4-10-17(18)21(26)24(22)16-8-2-1-3-9-16/h1-5,7-11,13-14H,6,12,15H2 |
| InChIKey | DXDWXSUFQTXPKI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|