C22H18N4O2S — CID 23973161
3-(4-oxo-3-phenylquinazolin-2-yl)sulfanyl-N-pyridin-3-ylpropanamide (PubChem CID 23973161) has the molecular formula C22H18N4O2S and a molecular weight of 402.48 g/mol. Its IUPAC name is 3-(4-oxo-3-phenylquinazolin-2-yl)sulfanyl-N-pyridin-3-ylpropanamide.
| Compound Name | 3-(4-oxo-3-phenylquinazolin-2-yl)sulfanyl-N-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 23973161 |
| Molecular Formula | C22H18N4O2S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 3-(4-oxo-3-phenylquinazolin-2-yl)sulfanyl-N-pyridin-3-ylpropanamide |
| SMILES | O=C(CCSc1nc2ccccc2c(=O)n1-c1ccccc1)Nc1cccnc1 |
| InChI | InChI=1S/C22H18N4O2S/c27-20(24-16-7-6-13-23-15-16)12-14-29-22-25-19-11-5-4-10-18(19)21(28)26(22)17-8-2-1-3-9-17/h1-11,13,15H,12,14H2,(H,24,27) |
| InChIKey | MCJQJTVAOZOEIM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |