C24H24N4OS2 — CID 42741437
N-(1-phenylethyl)-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanamide (PubChem CID 42741437) has the molecular formula C24H24N4OS2 and a molecular weight of 448.62 g/mol. Its IUPAC name is N-(1-phenylethyl)-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanamide.
| Compound Name | N-(1-phenylethyl)-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 42741437 |
| Molecular Formula | C24H24N4OS2 |
| Molecular Weight | 448.62 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N-(1-phenylethyl)-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanamide |
| SMILES | CC(NC(=O)CCCSc1nnc(-c2cccs2)n1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H24N4OS2/c1-18(19-10-4-2-5-11-19)25-22(29)15-9-17-31-24-27-26-23(21-14-8-16-30-21)28(24)20-12-6-3-7-13-20/h2-8,10-14,16,18H,9,15,17H2,1H3,(H,25,29) |
| InChIKey | MCLCLBNUUUFMMK-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.62 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|