C28H30N4OS — CID 42742250
5-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1-phenylethyl)pentanamide (PubChem CID 42742250) has the molecular formula C28H30N4OS and a molecular weight of 470.64 g/mol. Its IUPAC name is 5-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1-phenylethyl)pentanamide.
| Compound Name | 5-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1-phenylethyl)pentanamide |
|---|---|
| PubChem CID | 42742250 |
| Molecular Formula | C28H30N4OS |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 5-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1-phenylethyl)pentanamide |
| SMILES | Cc1ccc(-c2nnc(SCCCCC(=O)NC(C)c3ccccc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H30N4OS/c1-21-16-18-24(19-17-21)27-30-31-28(32(27)25-13-7-4-8-14-25)34-20-10-9-15-26(33)29-22(2)23-11-5-3-6-12-23/h3-8,11-14,16-19,22H,9-10,15,20H2,1-2H3,(H,29,33) |
| InChIKey | YXLYAQFXZRZROS-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|