C29H32N4OS — CID 4273334
4-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-phenylbutan-2-yl)butanamide (PubChem CID 4273334) has the molecular formula C29H32N4OS and a molecular weight of 484.67 g/mol. Its IUPAC name is 4-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-phenylbutan-2-yl)butanamide.
| Compound Name | 4-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-phenylbutan-2-yl)butanamide |
|---|---|
| PubChem CID | 4273334 |
| Molecular Formula | C29H32N4OS |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 4-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-phenylbutan-2-yl)butanamide |
| SMILES | Cc1ccc(-c2nnc(SCCCC(=O)NC(C)CCc3ccccc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H32N4OS/c1-22-15-19-25(20-16-22)28-31-32-29(33(28)26-12-7-4-8-13-26)35-21-9-14-27(34)30-23(2)17-18-24-10-5-3-6-11-24/h3-8,10-13,15-16,19-20,23H,9,14,17-18,21H2,1-2H3,(H,30,34) |
| InChIKey | ULHFHPYDEHNFQB-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|