C27H35N5O2S — CID 42741883
5-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-morpholin-4-ylpropyl)pentanamide (PubChem CID 42741883) has the molecular formula C27H35N5O2S and a molecular weight of 493.68 g/mol. Its IUPAC name is 5-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-morpholin-4-ylpropyl)pentanamide.
| Compound Name | 5-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-morpholin-4-ylpropyl)pentanamide |
|---|---|
| PubChem CID | 42741883 |
| Molecular Formula | C27H35N5O2S |
| Molecular Weight | 493.68 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | 5-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-morpholin-4-ylpropyl)pentanamide |
| SMILES | O=C(CCCCSc1nnc(Cc2ccccc2)n1-c1ccccc1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C27H35N5O2S/c33-26(28-15-9-16-31-17-19-34-20-18-31)14-7-8-21-35-27-30-29-25(22-23-10-3-1-4-11-23)32(27)24-12-5-2-6-13-24/h1-6,10-13H,7-9,14-22H2,(H,28,33) |
| InChIKey | FIXBITBDLYKNMF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.68 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|