C24H30N4O2S — CID 42730810
5-[[5-benzyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-propylpentanamide (PubChem CID 42730810) has the molecular formula C24H30N4O2S and a molecular weight of 438.60 g/mol. Its IUPAC name is 5-[[5-benzyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-propylpentanamide.
| Compound Name | 5-[[5-benzyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-propylpentanamide |
|---|---|
| PubChem CID | 42730810 |
| Molecular Formula | C24H30N4O2S |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 5-[[5-benzyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-propylpentanamide |
| SMILES | CCCNC(=O)CCCCSc1nnc(Cc2ccccc2)n1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H30N4O2S/c1-3-16-25-23(29)11-7-8-17-31-24-27-26-22(18-19-9-5-4-6-10-19)28(24)20-12-14-21(30-2)15-13-20/h4-6,9-10,12-15H,3,7-8,11,16-18H2,1-2H3,(H,25,29) |
| InChIKey | OIAYAURMLJDXJA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|