C27H30N6O2S2 — CID 4040669
2-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-(3-morpholin-4-ylpropyl)-1,3-thiazole-4-carboxamide (PubChem CID 4040669) has the molecular formula C27H30N6O2S2 and a molecular weight of 534.71 g/mol. Its IUPAC name is 2-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-(3-morpholin-4-ylpropyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-(3-morpholin-4-ylpropyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 4040669 |
| Molecular Formula | C27H30N6O2S2 |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 2-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-(3-morpholin-4-ylpropyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1csc(CSc2nnc(Cc3ccccc3)n2-c2ccccc2)n1 |
| InChI | InChI=1S/C27H30N6O2S2/c34-26(28-12-7-13-32-14-16-35-17-15-32)23-19-36-25(29-23)20-37-27-31-30-24(18-21-8-3-1-4-9-21)33(27)22-10-5-2-6-11-22/h1-6,8-11,19H,7,12-18,20H2,(H,28,34) |
| InChIKey | BQISGZIMPZAADG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|